70-69-9 4'-Aminopropiophenone
Nama produk |
4'-Aminopropiophenone |
Nama Inggeris |
4'-Aminopropiophenone; 4-Aminopropiophenone; para-Aminopropiophenone; p-Aminopropiophenone |
MF |
C9H11NO |
Berat Molekul |
149.1897 |
InChI |
InChI=1/C9H11NO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
CAS NO |
70-69-9 |
EINECS |
200-742-7 |
Struktur Molekul |
|
Kepadatan |
1.067g/cm3 |
Titik lebur |
137-143℃ |
Titik didih |
305.8°C at 760 mmHg |
Indeks bias |
1.559 |
Titik nyala |
138.7°C |
Tekanan wap |
0.000805mmHg at 25°C |
Cinta bahaya |
T:Toxic;
|
Kod Risiko |
R25:Toxic if swallowed.;
|
Keselamatan Penerangan |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|