ChemNet > CAS > 7197-96-8 2,3-cycloheptenopyridine
7197-96-8 2,3-cycloheptenopyridine
Nama produk |
2,3-cycloheptenopyridine |
Nama Inggeris |
2,3-cycloheptenopyridine; |
MF |
C10H13N |
Berat Molekul |
147.2169 |
InChI |
InChI=1/C10H13N/c1-2-5-9-6-4-8-11-10(9)7-3-1/h4,6,8H,1-3,5,7H2 |
CAS NO |
7197-96-8 |
EINECS |
230-568-7 |
Struktur Molekul |
|
Kepadatan |
0.999g/cm3 |
Titik didih |
224.9°C at 760 mmHg |
Indeks bias |
1.533 |
Titik nyala |
93.3°C |
Tekanan wap |
0.133mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|