ChemNet > CAS > 72235-55-3 3-Chloro-2-fluorobenzylamine
72235-55-3 3-Chloro-2-fluorobenzylamine
| Nama produk |
3-Chloro-2-fluorobenzylamine |
| Nama Inggeris |
3-Chloro-2-fluorobenzylamine; 1-(3-chloro-2-fluorophenyl)methanamine |
| MF |
C7H7ClFN |
| Berat Molekul |
159.5886 |
| InChI |
InChI=1/C7H7ClFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4,10H2 |
| CAS NO |
72235-55-3 |
| Struktur Molekul |
|
| Kepadatan |
1.27g/cm3 |
| Titik didih |
219.6°C at 760 mmHg |
| Indeks bias |
1.543 |
| Titik nyala |
86.6°C |
| Tekanan wap |
0.119mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
