ChemNet > CAS > 7335-27-5 Ethyl 4-chlorobenzoate
7335-27-5 Ethyl 4-chlorobenzoate
| Nama produk |
Ethyl 4-chlorobenzoate |
| Nama Inggeris |
Ethyl 4-chlorobenzoate; 4-Chlorobenzoic acid ethyl ester |
| MF |
C9H9ClO2 |
| Berat Molekul |
184.6196 |
| InChI |
InChI=1/C9H9ClO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| CAS NO |
7335-27-5 |
| EINECS |
230-844-7 |
| Struktur Molekul |
|
| Kepadatan |
1.185g/cm3 |
| Titik didih |
238.1°C at 760 mmHg |
| Indeks bias |
1.522 |
| Titik nyala |
107.2°C |
| Tekanan wap |
0.0432mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
