7355-22-8 5-Bromo-§
Nama produk |
5-Bromo-§ |
Nama Inggeris |
5-Bromo-§ 5-Bromo-2,4-dihydroxybenzoic acid monohydrate; 5-bromo-2,4-dihydroxybenzoic acid |
MF |
C7H5BrO4 |
Berat Molekul |
233.0162 |
InChI |
InChI=1/C7H5BrO4/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2,9-10H,(H,11,12) |
CAS NO |
7355-22-8 |
EINECS |
230-881-9 |
Struktur Molekul |
|
Kepadatan |
2.026g/cm3 |
Titik didih |
436.7°C at 760 mmHg |
Indeks bias |
1.703 |
Titik nyala |
217.9°C |
Tekanan wap |
2.13E-08mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|