ChemNet > CAS > 74772-17-1 3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid
74772-17-1 3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid
Nama produk |
3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid |
Nama Inggeris |
3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid; |
MF |
C9H7NO2S |
Berat Molekul |
193.2224 |
InChI |
InChI=1/C9H7NO2S/c11-9(12)8-7(3-6-13-8)10-4-1-2-5-10/h1-6H,(H,11,12) |
CAS NO |
74772-17-1 |
Struktur Molekul |
|
Kepadatan |
1.37g/cm3 |
Titik lebur |
174℃ |
Titik didih |
377.3°C at 760 mmHg |
Indeks bias |
1.669 |
Titik nyala |
182°C |
Tekanan wap |
2.31E-06mmHg at 25°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|