ChemNet > CAS > 75-27-4 Bromodichloromethane
75-27-4 Bromodichloromethane
Nama produk |
Bromodichloromethane |
Nama Inggeris |
Bromodichloromethane; FC-20B1 |
MF |
CHBrCl2 |
Berat Molekul |
163.8286 |
InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
CAS NO |
75-27-4 |
EINECS |
200-856-7 |
Struktur Molekul |
|
Kepadatan |
2.013g/cm3 |
Titik lebur |
-55℃ |
Titik didih |
89.7°C at 760 mmHg |
Indeks bias |
1.503 |
Titik nyala |
1.3°C |
Tekanan wap |
65.3mmHg at 25°C |
Cinta bahaya |
Xn:Harmful;
|
Kod Risiko |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|