ChemNet > CAS > 7560-44-3 Methyl 4-chlorocinnamate
7560-44-3 Methyl 4-chlorocinnamate
Nama produk |
Methyl 4-chlorocinnamate |
Nama Inggeris |
Methyl 4-chlorocinnamate; 4-Chlorocinnamic acid methyl ester; methyl 3-(4-chlorophenyl)prop-2-enoate; methyl (2E)-3-(4-chlorophenyl)prop-2-enoate |
MF |
C10H9ClO2 |
Berat Molekul |
196.6303 |
InChI |
InChI=1/C10H9ClO2/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7H,1H3/b7-4+ |
CAS NO |
7560-44-3 |
EINECS |
231-451-3 |
Struktur Molekul |
|
Kepadatan |
1.211g/cm3 |
Titik lebur |
76-77℃ |
Titik didih |
292.8°C at 760 mmHg |
Indeks bias |
1.572 |
Titik nyala |
144.4°C |
Tekanan wap |
0.0018mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|