ChemNet > CAS > 765-87-7 1,2-Cyclohexanedione
765-87-7 1,2-Cyclohexanedione
| Nama produk |
1,2-Cyclohexanedione |
| Nama Inggeris |
1,2-Cyclohexanedione;1,2-Dioxocyclohexane; 4-07-00-01982 (Beilstein Handbook Reference); AI3-25042; BRN 0507419; CCRIS 6296; NSC 32950; cyclohexane-1,2-dione |
| MF |
C12H18O3 |
| Berat Molekul |
210.2695 |
| InChI |
InChI=1/C12H18O3/c1-3-7-11-9(5-1)13-12(15-11)8-4-2-6-10(12)14-11/h9-10H,1-8H2 |
| CAS NO |
765-87-7 |
| EINECS |
212-155-3 |
| Struktur Molekul |
|
| Titik lebur |
35-38℃ |
| Indeks bias |
1.546 |
| Kelarutan air |
soluble |
| Cinta bahaya |
 Xn:Harmful;
|
| Kod Risiko |
R22:;
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
