ChemNet > CAS > 771-97-1 2,3-Diaminonaphthalene
771-97-1 2,3-Diaminonaphthalene
| Nama produk |
2,3-Diaminonaphthalene |
| Nama Inggeris |
2,3-Diaminonaphthalene; 2,3-Naphthalenediamine; naphthalene-2,3-diamine |
| MF |
C10H10N2 |
| Berat Molekul |
158.1998 |
| InChI |
InChI=1/C10H10N2/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6H,11-12H2 |
| CAS NO |
771-97-1 |
| EINECS |
212-241-0 |
| Struktur Molekul |
|
| Kepadatan |
1.234g/cm3 |
| Titik lebur |
193-199℃ |
| Titik didih |
370.6°C at 760 mmHg |
| Indeks bias |
1.757 |
| Titik nyala |
212.3°C |
| Tekanan wap |
1.1E-05mmHg at 25°C |
| Cinta bahaya |
 Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
