782-17-2 2-(4-Fluorophenyl)indole
Nama produk |
2-(4-Fluorophenyl)indole |
Nama Inggeris |
2-(4-Fluorophenyl)indole; 2-(naphth-2-yl)-1h-indole; 2-(4-fluorophenyl)-1H-indole; 6-(4-fluorophenyl)-1H-indole |
MF |
C14H10FN |
Berat Molekul |
211.2343 |
InChI |
InChI=1/C14H10FN/c15-13-5-3-10(4-6-13)12-2-1-11-7-8-16-14(11)9-12/h1-9,16H |
CAS NO |
782-17-2 |
Struktur Molekul |
|
Kepadatan |
1.233g/cm3 |
Titik lebur |
190-192℃ |
Titik didih |
389.094°C at 760 mmHg |
Indeks bias |
1.658 |
Titik nyala |
189.118°C |
Tekanan wap |
0mmHg at 25°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|