ChemNet > CAS > 79757-77-0 (4-bromo-2-thienyl)methanol
79757-77-0 (4-bromo-2-thienyl)methanol
| Nama produk |
(4-bromo-2-thienyl)methanol |
| Nama Inggeris |
(4-bromo-2-thienyl)methanol; (4-bromothiophen-2-yl)methanol; (4-Bromothien-2-yl)methanol |
| MF |
C5H5BrOS |
| Berat Molekul |
193.0616 |
| InChI |
InChI=1/C5H5BrOS/c6-4-1-5(2-7)8-3-4/h1,3,7H,2H2 |
| CAS NO |
79757-77-0 |
| Struktur Molekul |
|
| Kepadatan |
1.773g/cm3 |
| Titik didih |
271.491°C at 760 mmHg |
| Indeks bias |
1.631 |
| Titik nyala |
117.994°C |
| Tekanan wap |
0.003mmHg at 25°C |
| Cinta bahaya |
 Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
