ChemNet > CAS > 80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
| Nama produk |
4-Methyl-3-nitrobenzeneboronic acid |
| Nama Inggeris |
4-Methyl-3-nitrobenzeneboronic acid; 4-Methyl-3-nitrophenylboronic acid; 3-Nitro-p-tolylboronic acid; (4-methyl-3-nitrophenyl)boronic acid; 4-methyl-3-nitrophenylboronic acid; 3-Nitropheny-4-methylphenylboronic acid |
| MF |
C7H8BNO4 |
| Berat Molekul |
180.9537 |
| InChI |
InChI=1/C7H8BNO4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4,10-11H,1H3 |
| CAS NO |
80500-27-2 |
| Struktur Molekul |
|
| Kepadatan |
1.33g/cm3 |
| Titik lebur |
265-270 °C(lit.) |
| Titik didih |
356.7°C at 760 mmHg |
| Indeks bias |
1.563 |
| Titik nyala |
169.5°C |
| Tekanan wap |
1.05E-05mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
