ChemNet > CAS > 81067-38-1 1-Bromo-2,3,5-trichlorobenzene
81067-38-1 1-Bromo-2,3,5-trichlorobenzene
Nama produk |
1-Bromo-2,3,5-trichlorobenzene |
Sinonim |
2,3,5-Trichlorobromobenzene |
MF |
C6H2BrCl3 |
Berat Molekul |
260.3431 |
InChI |
InChI=1/C6H2BrCl3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
CAS NO |
81067-38-1 |
Struktur Molekul |
|
Kepadatan |
1.84g/cm3 |
Titik lebur |
58-61℃ |
Titik didih |
270.8°C at 760 mmHg |
Indeks bias |
1.603 |
Titik nyala |
129.3°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|