ChemNet > CAS > 83-24-9 2,5-Dimethyl-1-phenylpyrrole
83-24-9 2,5-Dimethyl-1-phenylpyrrole
| Nama produk |
2,5-Dimethyl-1-phenylpyrrole |
| Nama Inggeris |
2,5-Dimethyl-1-phenylpyrrole;1H-Pyrrole, 2,5-dimethyl-1-phenyl-; NSC 163170; 2,5-Dimethyl-1-phenyl-1H-pyrrole; Pyrrole, 2,5-dimethyl-1-phenyl- (8CI); 1-cyclohexyl-2,5-dimethyl-1H-pyrrole; 2,5-dimethyl-1-phenylpyrrolidine |
| MF |
C12H17N |
| Berat Molekul |
175.2701 |
| InChI |
InChI=1/C12H17N/c1-10-8-9-11(2)13(10)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
| CAS NO |
83-24-9 |
| EINECS |
201-461-2 |
| Struktur Molekul |
|
| Kepadatan |
0.952g/cm3 |
| Titik lebur |
50-51℃ |
| Titik didih |
257.7°C at 760 mmHg |
| Indeks bias |
1.519 |
| Titik nyala |
100.2°C |
| Tekanan wap |
0.0143mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
