ChemNet > CAS > 84540-59-0 4-Methyl-3-nitrobenzyl chloride
84540-59-0 4-Methyl-3-nitrobenzyl chloride
Nama produk |
4-Methyl-3-nitrobenzyl chloride |
Nama Inggeris |
4-Methyl-3-nitrobenzyl chloride; 4-(Chloromethyl)-2-nitrotoluene; 4-(chloromethyl)-1-methyl-2-nitrobenzene |
MF |
C8H8ClNO2 |
Berat Molekul |
185.6076 |
InChI |
InChI=1/C8H8ClNO2/c1-6-2-3-7(5-9)4-8(6)10(11)12/h2-4H,5H2,1H3 |
CAS NO |
84540-59-0 |
EINECS |
283-154-3 |
Struktur Molekul |
|
Kepadatan |
1.277g/cm3 |
Titik lebur |
46-50℃ |
Titik didih |
336.5°C at 760 mmHg |
Indeks bias |
1.566 |
Titik nyala |
133.3°C |
Tekanan wap |
0.000218mmHg at 25°C |
Cinta bahaya |
C:Corrosive;
|
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|