ChemNet > CAS > 84544-86-5 2-(phenylthio)ethanimidamide hydrochloride
84544-86-5 2-(phenylthio)ethanimidamide hydrochloride
| Nama produk |
2-(phenylthio)ethanimidamide hydrochloride |
| Sinonim |
; 2-(Phenylthio)acetamidine hydrochloride; (1Z)-2-(phenylsulfanyl)ethanimidamide hydrochloride; 1-amino-2-(phenylsulfanyl)ethaniminium |
| Nama Inggeris |
2-(phenylthio)ethanimidamide hydrochloride; 2-(Phenylthio)acetamidine hydrochloride; (1Z)-2-(phenylsulfanyl)ethanimidamide hydrochloride; 1-amino-2-(phenylsulfanyl)ethaniminium |
| MF |
C8H11N2S |
| Berat Molekul |
167.2508 |
| InChI |
InChI=1/C8H10N2S/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H3,9,10)/p+1 |
| CAS NO |
84544-86-5 |
| Struktur Molekul |
|
| Titik lebur |
175℃ |
| Titik didih |
276.3°C at 760 mmHg |
| Titik nyala |
120.9°C |
| Tekanan wap |
0.00485mmHg at 25°C |
| Cinta bahaya |
Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|