ChemNet > CAS > 84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
Nama produk |
4-Dimethylamino-2-methoxybenzaldehyde |
Nama Inggeris |
4-Dimethylamino-2-methoxybenzaldehyde; |
MF |
C10H13NO2 |
Berat Molekul |
179.2157 |
InChI |
InChI=1/C10H13NO2/c1-11(2)9-5-4-8(7-12)10(6-9)13-3/h4-7H,1-3H3 |
CAS NO |
84562-48-1 |
Struktur Molekul |
|
Kepadatan |
1.098g/cm3 |
Titik lebur |
59-60℃ |
Titik didih |
305.9°C at 760 mmHg |
Indeks bias |
1.576 |
Titik nyala |
138.8°C |
Tekanan wap |
0.000796mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|