85-02-9 5,6-Benzoquinoline
Nama produk |
5,6-Benzoquinoline |
Nama Inggeris |
5,6-Benzoquinoline; beta-Naphthoquinoline; 1-Azaphenanthrene; Benzo[f]quinoline; Benzoquinoline; benzo(f)quinoline |
MF |
C13H9N |
Berat Molekul |
179.2173 |
InChI |
InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
CAS NO |
85-02-9 |
EINECS |
201-582-0 |
Struktur Molekul |
|
Kepadatan |
1.187g/cm3 |
Titik lebur |
89-91℃ |
Titik didih |
350.4°C at 760 mmHg |
Indeks bias |
1.726 |
Titik nyala |
155.9°C |
Tekanan wap |
8.89E-05mmHg at 25°C |
Cinta bahaya |
Xn:Harmful;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|