877-43-0 2,6-Dimethylquinoline
Nama produk |
2,6-Dimethylquinoline |
Nama Inggeris |
2,6-Dimethylquinoline; 6-METHYLQUINALDINE; 2,6-dimethyl-quinolin; P-TOLUQUINALDINE; Quinoline, 2,6-dimethyl- |
MF |
C11H11N |
Berat Molekul |
157.2117 |
InChI |
InChI=1/C11H11N/c1-8-3-6-11-10(7-8)5-4-9(2)12-11/h3-7H,1-2H3 |
CAS NO |
877-43-0 |
EINECS |
212-891-5 |
Struktur Molekul |
|
Kepadatan |
1.052g/cm3 |
Titik lebur |
56-60 °C |
Titik didih |
266.5°C at 760 mmHg |
Indeks bias |
1.61 |
Titik nyala |
106.5°C |
Tekanan wap |
0.0142mmHg at 25°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|