ChemNet > CAS > 878-00-2 4-Acetoxybenzaldehyde
878-00-2 4-Acetoxybenzaldehyde
| Nama produk |
4-Acetoxybenzaldehyde |
| Nama Inggeris |
4-Acetoxybenzaldehyde; 4-Formylphenyl acetate |
| MF |
C9H8O3 |
| Berat Molekul |
164.158 |
| InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-8(6-10)3-5-9/h2-6H,1H3 |
| CAS NO |
878-00-2 |
| EINECS |
212-898-3 |
| Struktur Molekul |
|
| Kepadatan |
1.183g/cm3 |
| Titik didih |
275°C at 760 mmHg |
| Indeks bias |
1.552 |
| Titik nyala |
119.4°C |
| Tekanan wap |
0.00522mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
