ChemNet > CAS > 886-38-4 Diphenylcyclopropenone
886-38-4 Diphenylcyclopropenone
| Nama produk |
Diphenylcyclopropenone |
| Nama Inggeris |
Diphenylcyclopropenone; Diphencyprone; 2,3-diphenylcycloprop-2-en-1-one; 1,2-Diphenylcycelopropen-3-One; 1,2-Diphenylcyclopropen-3-one |
| MF |
C15H10O |
| Berat Molekul |
206.2393 |
| InChI |
InChI=1/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
| CAS NO |
886-38-4 |
| EINECS |
212-948-4 |
| Struktur Molekul |
|
| Kepadatan |
1.232g/cm3 |
| Titik lebur |
119-121℃ |
| Titik didih |
407.2°C at 760 mmHg |
| Indeks bias |
1.668 |
| Titik nyala |
182.7°C |
| Tekanan wap |
7.66E-07mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R43:May cause sensitization by skin contact.;
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
