ChemNet > CAS > 89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
| Nama produk |
Methyl-2-chloro-6-methylpyrimidine-4-carboxylate |
| Nama Inggeris |
Methyl-2-chloro-6-methylpyrimidine-4-carboxylate; Methyl 2-chloro-6-methylpyrimidine-4-carboxylate |
| MF |
C7H7ClN2O2 |
| Berat Molekul |
186.5957 |
| InChI |
InChI=1/C7H7ClN2O2/c1-4-3-5(6(11)12-2)10-7(8)9-4/h3H,1-2H3 |
| CAS NO |
89793-11-3 |
| Struktur Molekul |
|
| Kepadatan |
1.314g/cm3 |
| Titik lebur |
107℃ |
| Titik didih |
306.5°C at 760 mmHg |
| Indeks bias |
1.53 |
| Titik nyala |
139.2°C |
| Tekanan wap |
0.000768mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
