ChemNet > CAS > 90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
Nama produk |
2-Hydroxy-4,6-dimethoxyacetophenone |
Nama Inggeris |
2-Hydroxy-4,6-dimethoxyacetophenone; xanthoxylin |
MF |
C10H12O4 |
Berat Molekul |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
CAS NO |
90-24-4 |
EINECS |
201-978-3 |
Struktur Molekul |
|
Kepadatan |
1.172g/cm3 |
Titik lebur |
80-82℃ |
Titik didih |
355.1°C at 760 mmHg |
Indeks bias |
1.527 |
Titik nyala |
141.2°C |
Tekanan wap |
1.57E-05mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|