ChemNet > CAS > 9002-83-9 poly(chlorotrifluoroethylene)
9002-83-9 poly(chlorotrifluoroethylene)
| Nama produk |
poly(chlorotrifluoroethylene) |
| Nama Inggeris |
poly(chlorotrifluoroethylene); halocarbon oil 27 insect cell*culture tested; Fluorolube grease; PCTFE; Fluorolube Grease, Gr-362 |
| MF |
C2ClF3 |
| Berat Molekul |
116.4693 |
| InChI |
InChI=1/C2ClF3/c3-1(4)2(5)6 |
| CAS NO |
9002-83-9 |
| Struktur Molekul |
|
| Kepadatan |
1.9 |
| Titik lebur |
210℃ |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
