ChemNet > CAS > 9017-21-4 Poli(vinyltoluene), isomer campuran
9017-21-4 Poli(vinyltoluene), isomer campuran
Nama produk |
Poli(vinyltoluene), isomer campuran |
Sinonim |
;p olyvinyltoluene; Vinyl toluene resin |
Nama Inggeris |
Poly(vinyltoluene), mixed isomers; polyvinyltoluene; Vinyl toluene resin |
MF |
(C9H10)x |
Berat Molekul |
118.178 |
InChI |
InChI=1/C9H10/c1-3-9-7-5-4-6-8(9)2/h3-7H,1H2,2H3 |
CAS NO |
9017-21-4 |
Struktur Molekul |
|
Titik didih |
100℃ |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|