493-01-6;91-17-8 cis-Decahydronaphthalene
Nama produk |
cis-Decahydronaphthalene |
Nama Inggeris |
cis-Decahydronaphthalene; cis-bicyclo(4.4.0)decane; cis-decaline; Decahydronaphthalene; Deca hydro naphthalene; Decalin |
MF |
C10H18 |
Berat Molekul |
138.2499 |
InChI |
InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
CAS NO |
493-01-6;91-17-8 |
EINECS |
202-046-9 |
Struktur Molekul |
|
Kepadatan |
0.873g/cm3 |
Titik lebur |
-31℃ |
Titik didih |
190.879°C at 760 mmHg |
Indeks bias |
1.47 |
Titik nyala |
57.222°C |
Kelarutan air |
6 mg/L at 20℃ |
Tekanan wap |
0.735mmHg at 25°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|