ChemNet > CAS > 91138-00-0 5-Methyl-1-phenylpyrazole-4-carboxylic acid
91138-00-0 5-Methyl-1-phenylpyrazole-4-carboxylic acid
Nama produk |
5-Methyl-1-phenylpyrazole-4-carboxylic acid |
Nama Inggeris |
5-Methyl-1-phenylpyrazole-4-carboxylic acid; 5-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid |
MF |
C11H10N2O2 |
Berat Molekul |
202.2093 |
InChI |
InChI=1/C11H10N2O2/c1-8-10(11(14)15)7-12-13(8)9-5-3-2-4-6-9/h2-7H,1H3,(H,14,15) |
CAS NO |
91138-00-0 |
Struktur Molekul |
|
Kepadatan |
1.24g/cm3 |
Titik lebur |
163℃ |
Titik didih |
382.9°C at 760 mmHg |
Indeks bias |
1.617 |
Titik nyala |
185.4°C |
Tekanan wap |
1.51E-06mmHg at 25°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|