ChemNet > CAS > 10036-64-3 2-Acetamido-2-deoxy-Alpha-D-glucopyranose
10036-64-3 2-Acetamido-2-deoxy-Alpha-D-glucopyranose
Naam product |
2-Acetamido-2-deoxy-Alpha-D-glucopyranose |
Engelse naam |
2-Acetamido-2-deoxy-Alpha-D-glucopyranose; N-Acetyl-alpha-D-glucosamine; AcetylDglucosamine; 2-(acetylamino)-2-deoxyhexopyranose; 2-(acetylamino)-2-deoxy-D-glucose; 2-(acetylamino)-2-deoxy-beta-L-talopyranose |
MF |
C8H15NO6 |
Molecuulgewicht |
221.2078 |
InChI |
InChI=1/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5+,6+,7-,8-/m0/s1 |
CAS-nummer |
10036-64-3 |
EINECS |
233-115-1 |
Moleculaire Structuur |
|
Dichtheid |
1.506g/cm3 |
Smeltpunt |
211℃ |
Kookpunt |
595.353°C at 760 mmHg |
Brekingsindex |
1.576 |
Vlampunt |
313.858°C |
Dampdruk |
0mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|