10047-28-6 butyl thioglycolate
Naam product |
butyl thioglycolate |
Engelse naam |
butyl thioglycolate; |
MF |
C6H12O2S |
Molecuulgewicht |
148.2233 |
InChI |
InChI=1/C6H12O2S/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
CAS-nummer |
10047-28-6 |
EINECS |
233-156-5 |
Moleculaire Structuur |
|
Dichtheid |
1.088g/cm3 |
Kookpunt |
220.125°C at 760 mmHg |
Brekingsindex |
1.491 |
Vlampunt |
86.929°C |
Dampdruk |
0.024mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|