101-89-3 Fast Garnet GBC salt
Naam product |
Fast Garnet GBC salt |
Engelse naam |
Fast Garnet GBC salt; Fast Garnet GBC sulfate salt; 2-Methyl-4-(o-tolylazo)benzenediazonium hydrogen sulphate; Fast Garnet GBC Salt; Benzenediazonium, 2-methyl-4-((2-methylphenyl)azo)-, sulfate (1:1); Benzenediazonium,2-methyl-4-[(2-methylphenyl) azo]-,sulfate (1:1);
|
MF |
C14H14N4O4S |
Molecuulgewicht |
334.3504 |
InChI |
InChI=1/C14H13N4.H2O4S/c1-10-5-3-4-6-14(10)18-17-12-7-8-13(16-15)11(2)9-12;1-5(2,3)4/h3-9H,1-2H3;(H2,1,2,3,4)/q+1;/p-1/b18-17+; |
CAS-nummer |
101-89-3 |
EINECS |
202-985-4 |
Moleculaire Structuur |
|
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R33:Danger of cummulative effects.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|