ChemNet > CAS > 1016-05-3 Dibenzothiophene sulfone
1016-05-3 Dibenzothiophene sulfone
| Naam product |
Dibenzothiophene sulfone |
| Engelse naam |
Dibenzothiophene sulfone; Dibenzothiophene-5,5-dioxide; dibenzo[b,d]thiophene 5,5-dioxide |
| MF |
C12H8O2S |
| Molecuulgewicht |
216.2557 |
| InChI |
InChI=1/C12H8O2S/c13-15(14)11-7-3-1-5-9(11)10-6-2-4-8-12(10)15/h1-8H |
| CAS-nummer |
1016-05-3 |
| EINECS |
213-805-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.396g/cm3 |
| Smeltpunt |
231-236℃ |
| Kookpunt |
422.2°C at 760 mmHg |
| Brekingsindex |
1.675 |
| Vlampunt |
275.7°C |
| Dampdruk |
6.03E-07mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
