10192-85-5 Potassium acrylate
Naam product |
Potassium acrylate |
Engelse naam |
Potassium acrylate; PotassiumAcrylateinmethanol; Potassiumacrylate; Acrylic acid potassium salt; 2-Propenoic acid, potassium salt; prop-2-enoic acid; potassium prop-2-enoate |
MF |
C3H3KO2 |
Molecuulgewicht |
110.153 |
InChI |
InChI=1/C3H4O2.K/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+1/p-1 |
CAS-nummer |
10192-85-5 |
EINECS |
233-473-9 |
Moleculaire Structuur |
|
Smeltpunt |
194℃ |
Kookpunt |
141°C at 760 mmHg |
Vlampunt |
61.6°C |
Dampdruk |
3.42mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|