ChemNet > CAS > 103-30-0 trans-Stilbene
103-30-0 trans-Stilbene
| Naam product |
trans-Stilbene |
| Engelse naam |
trans-Stilbene; trans-1,1-(1,2-Ethenediyl)bis(benzene); 1,1'-ethene-1,1-diyldibenzene; 1,1'-(E)-ethene-1,2-diyldibenzene; 1,1'-(Z)-ethene-1,2-diyldibenzene |
| MF |
C14H12 |
| Molecuulgewicht |
180.2451 |
| InChI |
InChI=1/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
| CAS-nummer |
103-30-0 |
| EINECS |
203-098-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.044g/cm3 |
| Smeltpunt |
122-126℃ |
| Kookpunt |
307°C at 760 mmHg |
| Brekingsindex |
1.658 |
| Vlampunt |
128.5°C |
| Dampdruk |
0.00135mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
