ChemNet > CAS > 10352-44-0 4-acetamidothioanisol, (4-methylmercaptoacetanilide)
10352-44-0 4-acetamidothioanisol, (4-methylmercaptoacetanilide)
Naam product |
4-acetamidothioanisol, (4-methylmercaptoacetanilide) |
Synoniemen |
4-acetamidothioanisol; 4-methylmercaptoacetanilide; N-[4-(methylsulfanyl)fenyl]acetamide |
Engelse naam |
4-Acetamidothioanisole,(4-Methylmercaptoacetanilide); 4-Acetamidothioanisole; 4-Methylmercaptoacetanilide; N-[4-(methylsulfanyl)phenyl]acetamide |
MF |
C9H11NOS |
Molecuulgewicht |
181.2547 |
InChI |
InChI=1/C9H11NOS/c1-7(11)10-8-3-5-9(12-2)6-4-8/h3-6H,1-2H3,(H,10,11) |
CAS-nummer |
10352-44-0 |
Moleculaire Structuur |
|
Dichtheid |
1.14g/cm3 |
Kookpunt |
370.5°C at 760 mmHg |
Brekingsindex |
1.578 |
Vlampunt |
177.9°C |
Dampdruk |
1.1E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|