Naam product |
4,4'-diaminooctafluorobifenyl |
Synoniemen |
2,2,3,3,5,5,6,6-octafluor-4,4-bibenzenamine; Octafluorobenzidine; octafluor-4,4-bifenyleendiamine; 4,4'-dibroom-2,2',3,3',5,5',6,6'-octafluorbifenyl |
Engelse naam |
4,4'-diaminooctafluorobiphenyl; 2,2,3,3,5,5,6,6-Octafluoro-4,4-bibenzenamine; Octafluorobenzidine; octafluoro-4,4-biphenylenediamine; 4,4'-dibromo-2,2',3,3',5,5',6,6'-octafluorobiphenyl |
MF |
C12Br2F8 |
Molecuulgewicht |
455.9236 |
InChI |
InChI=1/C12Br2F8/c13-3-9(19)5(15)1(6(16)10(3)20)2-7(17)11(21)4(14)12(22)8(2)18 |
CAS-nummer |
1038-66-0 |
EINECS |
213-861-4 |
Moleculaire Structuur |
|
Dichtheid |
2.065g/cm3 |
Smeltpunt |
175-179℃ |
Kookpunt |
295.4°C at 760 mmHg |
Brekingsindex |
1.511 |
Vlampunt |
132.4°C |
Dampdruk |
0.0027mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|