ChemNet > CAS > 104-45-0 1-methoxy-4-propylbenzeen
104-45-0 1-methoxy-4-propylbenzeen
| Naam product |
1-methoxy-4-propylbenzeen |
| Synoniemen |
4-propylanisol = dihydroanethol = p-propylanisole; 4-n-propylanisole |
| Engelse naam |
1-Methoxy-4-propylbenzene; 4-Propylanisole = Dihydroanethole = p-Propylanisole; 4-n-Propylanisole |
| MF |
C10H14O |
| Molecuulgewicht |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-3-4-9-5-7-10(11-2)8-6-9/h5-8H,3-4H2,1-2H3 |
| CAS-nummer |
104-45-0 |
| EINECS |
203-203-4 |
| Moleculaire Structuur |
|
| Dichtheid |
0.922g/cm3 |
| Kookpunt |
211.4°C at 760 mmHg |
| Brekingsindex |
1.49 |
| Vlampunt |
82.3°C |
| Dampdruk |
0.266mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|