104-66-5 1,2-Diphenoxyethane
Naam product |
1,2-Diphenoxyethane |
Engelse naam |
1,2-Diphenoxyethane; Ethylene glycol diphenyl ether; 1,1'-[ethane-1,2-diylbis(oxy)]dibenzene; 1,2-Diphenoxy ethane |
MF |
C14H14O2 |
Molecuulgewicht |
214.2598 |
InChI |
InChI=1/C14H14O2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2 |
CAS-nummer |
104-66-5 |
EINECS |
203-224-9 |
Moleculaire Structuur |
|
Dichtheid |
1.08g/cm3 |
Smeltpunt |
95-98℃ |
Kookpunt |
341.6°C at 760 mmHg |
Brekingsindex |
1.556 |
Vlampunt |
139.4°C |
Dampdruk |
0.000158mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|