ChemNet > CAS > 10546-65-3 2,6-Dibromo-4-isopropylaniline
10546-65-3 2,6-Dibromo-4-isopropylaniline
| Naam product |
2,6-Dibromo-4-isopropylaniline |
| Engelse naam |
2,6-Dibromo-4-isopropylaniline; 2,6-Dibromo-4-n-propylaniline; 2,6-dibromo-4-(propan-2-yl)aniline; 2,6-dibromo-4-(1-methylethyl)-Benzenamine |
| MF |
C9H11Br2N |
| Molecuulgewicht |
292.9983 |
| InChI |
InChI=1/C9H11Br2N/c1-5(2)6-3-7(10)9(12)8(11)4-6/h3-5H,12H2,1-2H3 |
| CAS-nummer |
10546-65-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.682g/cm3 |
| Kookpunt |
310.6°C at 760 mmHg |
| Brekingsindex |
1.605 |
| Vlampunt |
141.6°C |
| Dampdruk |
0.000595mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
