ChemNet > CAS > 10570-67-9 4-iodo-2,6-dimethylphenol
10570-67-9 4-iodo-2,6-dimethylphenol
| Naam product |
4-iodo-2,6-dimethylphenol |
| Engelse naam |
4-iodo-2,6-dimethylphenol; 2,6-Dimethyl-4-iodophenol; 4-IODO-2,6-XYLENOL; 4-lodo-2,6-dimethyl phenol |
| MF |
C8H9IO |
| Molecuulgewicht |
248.0609 |
| InChI |
InChI=1/C8H9IO/c1-5-3-7(9)4-6(2)8(5)10/h3-4,10H,1-2H3 |
| CAS-nummer |
10570-67-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.74g/cm3 |
| Smeltpunt |
96℃ |
| Kookpunt |
278.9°C at 760 mmHg |
| Brekingsindex |
1.629 |
| Vlampunt |
122.5°C |
| Dampdruk |
0.00244mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
