ChemNet > CAS > 107535-73-9 2,3,5,6-Tetrafluorobenzoyl chloride
107535-73-9 2,3,5,6-Tetrafluorobenzoyl chloride
| Naam product |
2,3,5,6-Tetrafluorobenzoyl chloride |
| Engelse naam |
2,3,5,6-Tetrafluorobenzoyl chloride; |
| MF |
C7HClF4O |
| Molecuulgewicht |
212.5289 |
| InChI |
InChI=1/C7HClF4O/c8-7(13)4-5(11)2(9)1-3(10)6(4)12/h1H |
| CAS-nummer |
107535-73-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.601g/cm3 |
| Kookpunt |
172.1°C at 760 mmHg |
| Brekingsindex |
1.461 |
| Vlampunt |
57.9°C |
| Dampdruk |
1.35mmHg at 25°C |
| Gevaarsymbolen |
 C:Corrosive;
|
| Risico-codes |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
