ChemNet > CAS > 107572-07-6 2-(4-Chlorophenylthio)benzaldehyde
107572-07-6 2-(4-Chlorophenylthio)benzaldehyde
| Naam product |
2-(4-Chlorophenylthio)benzaldehyde |
| Engelse naam |
2-(4-Chlorophenylthio)benzaldehyde; 2-[(4-Chlorophenyl)thio]benzaldehyde; 2-[(4-chlorophenyl)sulfanyl]benzaldehyde |
| MF |
C13H9ClOS |
| Molecuulgewicht |
248.728 |
| InChI |
InChI=1/C13H9ClOS/c14-11-5-7-12(8-6-11)16-13-4-2-1-3-10(13)9-15/h1-9H |
| CAS-nummer |
107572-07-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.31g/cm3 |
| Smeltpunt |
72℃ |
| Kookpunt |
370.3°C at 760 mmHg |
| Brekingsindex |
1.654 |
| Vlampunt |
177.8°C |
| Dampdruk |
1.12E-05mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
