ChemNet > CAS > 1076-74-0 5-Methoxy-2-methylindole
1076-74-0 5-Methoxy-2-methylindole
Naam product |
5-Methoxy-2-methylindole |
Engelse naam |
5-Methoxy-2-methylindole;5-methoxy-2-methyl-1H-indole |
MF |
C10H11NO |
Molecuulgewicht |
161.2004 |
InChI |
InChI=1/C10H11NO/c1-7-5-8-6-9(12-2)3-4-10(8)11-7/h3-6,11H,1-2H3 |
CAS-nummer |
1076-74-0 |
EINECS |
214-066-5 |
Moleculaire Structuur |
|
Dichtheid |
1.134g/cm3 |
Smeltpunt |
85-88℃ |
Kookpunt |
308.5°C at 760 mmHg |
Brekingsindex |
1.621 |
Vlampunt |
113.1°C |
Dampdruk |
0.00123mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|