1081-75-0 1,3-Diphenylpropane
Naam product |
1,3-Diphenylpropane |
Engelse naam |
1,3-Diphenylpropane;NSC 54371; Benzene, 1,1'-(1,3-propanediyl)bis- (9CI); Propane, 1,3-diphenyl- (8CI); 1,1'-propane-1,3-diyldibenzene |
MF |
C15H16 |
Molecuulgewicht |
196.2875 |
InChI |
InChI=1/C15H16/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2 |
CAS-nummer |
1081-75-0 |
EINECS |
214-101-4 |
Moleculaire Structuur |
|
Dichtheid |
0.984g/cm3 |
Kookpunt |
300.3°C at 760 mmHg |
Brekingsindex |
1.564 |
Vlampunt |
129.2°C |
Dampdruk |
0.00202mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|