110-42-9 Methyl caprate
Naam product |
Methyl caprate |
Engelse naam |
Methyl caprate; Methyl decanoate; Capric acid methyl ester~Decanoic acid methyl ester~Methyl decanoate; METHYLE N-CAPRINATE |
MF |
C11H22O2 |
Molecuulgewicht |
186.2912 |
InChI |
InChI=1/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 |
CAS-nummer |
110-42-9 |
EINECS |
203-766-6 |
Moleculaire Structuur |
|
Dichtheid |
0.872g/cm3 |
Smeltpunt |
-11--14℃ |
Kookpunt |
224°C at 760 mmHg |
Brekingsindex |
1.426 |
Vlampunt |
94.4°C |
Dampdruk |
0.0934mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|