Naam product |
2,4,7-trinitro-9H-fluor-9-on - 3,4,7-trimethyl-1-benzothiofeen (1:1) |
Synoniemen |
; 2,4,7-trinitrofluoreen-9-on compd.met 3,4,7-trimethylbenzo(b)thiofeen (1:1); Fluor-9-on, 2,4,7-trinitro-, compd.met 3,4,7-trimethylbenzo(b)thiofeen (1:1) |
Engelse naam |
2,4,7-trinitro-9H-fluoren-9-one - 3,4,7-trimethyl-1-benzothiophene (1:1); 2,4,7-Trinitrofluoren-9-one compd. with 3,4,7-trimethylbenzo(b)thiophene (1:1); Fluoren-9-one, 2,4,7-trinitro-, compd. with 3,4,7-trimethylbenzo(b)thiophene (1:1) |
MF |
C24H17N3O7S |
Molecuulgewicht |
491.4727 |
InChI |
InChI=1/C13H5N3O7.C11H12S/c17-13-9-3-6(14(18)19)1-2-8(9)12-10(13)4-7(15(20)21)5-11(12)16(22)23;1-7-4-5-8(2)11-10(7)9(3)6-12-11/h1-5H;4-6H,1-3H3 |
CAS-nummer |
1108-42-5 |
Moleculaire Structuur |
|
Kookpunt |
561.7°C at 760 mmHg |
Vlampunt |
292.3°C |
Dampdruk |
1.2E-12mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|