ChemNet > CAS > 111-21-7 Triethyleneglycoldiacetate
111-21-7 Triethyleneglycoldiacetate
Naam product |
Triethyleneglycoldiacetate |
Engelse naam |
Triethyleneglycoldiacetate; Triethylene glycol diacetate; ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
MF |
C10H18O6 |
Molecuulgewicht |
234.2463 |
InChI |
InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
CAS-nummer |
111-21-7 |
EINECS |
203-846-0 |
Moleculaire Structuur |
|
Dichtheid |
1.098g/cm3 |
Kookpunt |
286°C at 760 mmHg |
Brekingsindex |
1.432 |
Vlampunt |
125.2°C |
Dampdruk |
0.00271mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|