ChemNet > CAS > 112-61-8 Methyl stearate
112-61-8 Methyl stearate
| Naam product |
Methyl stearate |
| Engelse naam |
Methyl stearate; Methyl n-octadecanoate; Stearic acid methyl ester; methyl octadecanoate; Me-ST |
| MF |
C19H38O2 |
| Molecuulgewicht |
298.5038 |
| InChI |
InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
| CAS-nummer |
112-61-8 |
| EINECS |
203-990-4 |
| Moleculaire Structuur |
|
| Dichtheid |
0.863g/cm3 |
| Smeltpunt |
37-39℃ |
| Kookpunt |
355.5°C at 760 mmHg |
| Brekingsindex |
1.444 |
| Vlampunt |
169.3°C |
| Dampdruk |
3.11E-05mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
