1123-00-8 Cyclopentylacetic acid
Naam product |
Cyclopentylacetic acid |
Engelse naam |
Cyclopentylacetic acid; Cyclopentaneacetic acid; cycylopentylacetic acid; cyclopentylacetate |
MF |
C7H11O2 |
Molecuulgewicht |
127.1616 |
InChI |
InChI=1/C7H12O2/c8-7(9)5-6-3-1-2-4-6/h6H,1-5H2,(H,8,9)/p-1 |
CAS-nummer |
1123-00-8 |
EINECS |
214-368-7 |
Moleculaire Structuur |
|
Kookpunt |
230.2°C at 760 mmHg |
Vlampunt |
114°C |
Dampdruk |
0.0237mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|