1124-39-6 4-Ethylcatechol
Naam product |
4-Ethylcatechol |
Engelse naam |
4-Ethylcatechol; 3,4-Dihydroxyethylbenzene; 4-ethylbenzene-1,2-diol |
MF |
C8H10O2 |
Molecuulgewicht |
138.1638 |
InChI |
InChI=1/C8H10O2/c1-2-6-3-4-7(9)8(10)5-6/h3-5,9-10H,2H2,1H3 |
CAS-nummer |
1124-39-6 |
EINECS |
214-397-5 |
Moleculaire Structuur |
|
Dichtheid |
1.159g/cm3 |
Kookpunt |
273.3°C at 760 mmHg |
Brekingsindex |
1.578 |
Vlampunt |
134.1°C |
Dampdruk |
0.00346mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|